C6H7F2N3 — CID 594438
4,6-difluoro-N,N-dimethylpyrimidin-2-amine (PubChem CID 594438) has the molecular formula C6H7F2N3 and a molecular weight of 159.14 g/mol. Its IUPAC name is 4,6-difluoro-N,N-dimethylpyrimidin-2-amine.
| Compound Name | 4,6-difluoro-N,N-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 594438 |
| Molecular Formula | C6H7F2N3 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | 4,6-difluoro-N,N-dimethylpyrimidin-2-amine |
| SMILES | CN(C)c1nc(F)cc(F)n1 |
| InChI | InChI=1S/C6H7F2N3/c1-11(2)6-9-4(7)3-5(8)10-6/h3H,1-2H3 |
| InChIKey | FETWNAISKMGRGN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |