C14H15N5O3 — CID 23487944
4-N-(2-methoxyphenyl)-5-nitro-6-N-prop-2-enylpyrimidine-4,6-diamine (PubChem CID 23487944) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is 4-N-(2-methoxyphenyl)-5-nitro-6-N-prop-2-enylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-methoxyphenyl)-5-nitro-6-N-prop-2-enylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23487944 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-N-(2-methoxyphenyl)-5-nitro-6-N-prop-2-enylpyrimidine-4,6-diamine |
| SMILES | C=CCNc1ncnc(Nc2ccccc2OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15N5O3/c1-3-8-15-13-12(19(20)21)14(17-9-16-13)18-10-6-4-5-7-11(10)22-2/h3-7,9H,1,8H2,2H3,(H2,15,16,17,18) |
| InChIKey | LZFPTNRPNAVWJZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|