C12H14N4O2 — CID 3104735
N-(3,4-dimethylphenyl)-5-methyl-4-nitro-1H-pyrazol-3-amine (PubChem CID 3104735) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-5-methyl-4-nitro-1H-pyrazol-3-amine.
| Compound Name | N-(3,4-dimethylphenyl)-5-methyl-4-nitro-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 3104735 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | N-(3,4-dimethylphenyl)-5-methyl-4-nitro-1H-pyrazol-3-amine |
| SMILES | Cc1ccc(Nc2n[nH]c(C)c2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C12H14N4O2/c1-7-4-5-10(6-8(7)2)13-12-11(16(17)18)9(3)14-15-12/h4-6H,1-3H3,(H2,13,14,15) |
| InChIKey | KGOLWXKQFBCTLE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|