C6H6N3O6S- — CID 7147584
2-[(5-methyl-4-nitro-1H-pyrazol-3-yl)sulfonyl]acetate (PubChem CID 7147584) has the molecular formula C6H6N3O6S- and a molecular weight of 248.20 g/mol. Its IUPAC name is 2-[(5-methyl-4-nitro-1H-pyrazol-3-yl)sulfonyl]acetate.
| Compound Name | 2-[(5-methyl-4-nitro-1H-pyrazol-3-yl)sulfonyl]acetate |
|---|---|
| PubChem CID | 7147584 |
| Molecular Formula | C6H6N3O6S- |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-[(5-methyl-4-nitro-1H-pyrazol-3-yl)sulfonyl]acetate |
| SMILES | Cc1[nH]nc(S(=O)(=O)CC(=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H7N3O6S/c1-3-5(9(12)13)6(8-7-3)16(14,15)2-4(10)11/h2H2,1H3,(H,7,8)(H,10,11)/p-1 |
| InChIKey | KCMHDTRAOLODSK-UHFFFAOYSA-M |
| XLogP | -1.85 |
| TPSA | 146.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|