C7H9N3O3 — CID 141229738
3,5-dimethyl-4-nitro-1H-pyrrole-2-carboxamide (PubChem CID 141229738) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 3,5-dimethyl-4-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | 3,5-dimethyl-4-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 141229738 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 3,5-dimethyl-4-nitro-1H-pyrrole-2-carboxamide |
| SMILES | Cc1[nH]c(C(N)=O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H9N3O3/c1-3-5(7(8)11)9-4(2)6(3)10(12)13/h9H,1-2H3,(H2,8,11) |
| InChIKey | QYEPZYNQVXIZLH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|