About 3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one
3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one (PubChem CID 536005) has the molecular formula C7H7ClN2O3
and a molecular weight of 202.60 g/mol. Its IUPAC name is 3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one |
| PubChem CID | 536005 |
| Molecular Formula | C7H7ClN2O3 |
| Molecular Weight | 202.60 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one |
| SMILES | Cc1[nH]c(C)c([N+](=O)[O-])c(=O)c1Cl |
| InChI | InChI=1S/C7H7ClN2O3/c1-3-5(8)7(11)6(10(12)13)4(2)9-3/h1-2H3,(H,9,11) |
| InChIKey | REPOCRWMUZOLBT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.60 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one?
The IUPAC name of 3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one (CID 536005) is 3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one.
What is the SMILES notation for 3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one?
The canonical SMILES for 3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one is Cc1[nH]c(C)c([N+](=O)[O-])c(=O)c1Cl.
What is the InChIKey of 3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one?
The InChIKey is REPOCRWMUZOLBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2O3/c1-3-5(8)7(11)6(10(12)13)4(2)9-3/h1-2H3,(H,9,11).
What are the key properties of 3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one?
3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one has a molecular weight of 202.60 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,6-dimethyl-5-nitro-1H-pyridin-4-one is sourced from PubChem (CID 536005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).