C8H9Cl2NO — CID 609392
3,5-dichloro-2-ethyl-6-methyl-1H-pyridin-4-one (PubChem CID 609392) has the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. Its IUPAC name is 3,5-dichloro-2-ethyl-6-methyl-1H-pyridin-4-one.
| Compound Name | 3,5-dichloro-2-ethyl-6-methyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 609392 |
| Molecular Formula | C8H9Cl2NO |
| Molecular Weight | 206.07 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 3,5-dichloro-2-ethyl-6-methyl-1H-pyridin-4-one |
| SMILES | CCc1[nH]c(C)c(Cl)c(=O)c1Cl |
| InChI | InChI=1S/C8H9Cl2NO/c1-3-5-7(10)8(12)6(9)4(2)11-5/h3H2,1-2H3,(H,11,12) |
| InChIKey | YYJOIXWZKTZUTF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.07 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |