C14H20Cl2N2O2 — CID 56695799
2,5-bis(tert-butylamino)-3,6-dichlorocyclohexa-2,5-diene-1,4-dione (PubChem CID 56695799) has the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.23 g/mol. Its IUPAC name is 2,5-bis(tert-butylamino)-3,6-dichlorocyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis(tert-butylamino)-3,6-dichlorocyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 56695799 |
| Molecular Formula | C14H20Cl2N2O2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2,5-bis(tert-butylamino)-3,6-dichlorocyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)(C)NC1=C(Cl)C(=O)C(NC(C)(C)C)=C(Cl)C1=O |
| InChI | InChI=1S/C14H20Cl2N2O2/c1-13(2,3)17-9-7(15)12(20)10(8(16)11(9)19)18-14(4,5)6/h17-18H,1-6H3 |
| InChIKey | LHDGDEUZCMIJOZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|