C7H11N3O3 — CID 56763728
5-tert-butyl-4-nitro-1,2-dihydropyrazol-3-one (PubChem CID 56763728) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 5-tert-butyl-4-nitro-1,2-dihydropyrazol-3-one.
| Compound Name | 5-tert-butyl-4-nitro-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 56763728 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 5-tert-butyl-4-nitro-1,2-dihydropyrazol-3-one |
| SMILES | CC(C)(C)c1[nH][nH]c(=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H11N3O3/c1-7(2,3)5-4(10(12)13)6(11)9-8-5/h1-3H3,(H2,8,9,11) |
| InChIKey | KFZCRAJRUGTZMQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|