C17H26BN4S — CID 161462779
CID 161462779 (PubChem CID 161462779) has the molecular formula C17H26BN4S and a molecular weight of 329.30 g/mol.
| Compound Name | CID 161462779 |
|---|---|
| PubChem CID | 161462779 |
| Molecular Formula | C17H26BN4S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | — |
| SMILES | CC.CC.CCn1cc(Cc2ccsc2)c2c(N)ncnc21.[B] |
| InChI | InChI=1S/C13H14N4S.2C2H6.B/c1-2-17-6-10(5-9-3-4-18-7-9)11-12(14)15-8-16-13(11)17;2*1-2;/h3-4,6-8H,2,5H2,1H3,(H2,14,15,16);2*1-2H3; |
| InChIKey | ZXTBCNGHSOVOSN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|