About 7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine
7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 68784661) has the molecular formula C8H9IN4
and a molecular weight of 288.09 g/mol. Its IUPAC name is 7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 68784661 |
| Molecular Formula | C8H9IN4 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCn1cc(I)c2c(N)ncnc21 |
| InChI | InChI=1S/C8H9IN4/c1-2-13-3-5(9)6-7(10)11-4-12-8(6)13/h3-4H,2H2,1H3,(H2,10,11,12) |
| InChIKey | RJRTWMPSBPWQFQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of 7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine (CID 68784661) is 7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine is CCn1cc(I)c2c(N)ncnc21.
What is the InChIKey of 7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is RJRTWMPSBPWQFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9IN4/c1-2-13-3-5(9)6-7(10)11-4-12-8(6)13/h3-4H,2H2,1H3,(H2,10,11,12).
What are the key properties of 7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine?
7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 288.09 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-5-iodopyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 68784661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).