C7H7IN4 — CID 176888439
5-iodo-7-(trideuteriomethyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 176888439) has the molecular formula C7H7IN4 and a molecular weight of 277.08 g/mol. Its IUPAC name is 5-iodo-7-(trideuteriomethyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-iodo-7-(trideuteriomethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 176888439 |
| Molecular Formula | C7H7IN4 |
| Molecular Weight | 277.08 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 5-iodo-7-(trideuteriomethyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | [2H]C([2H])([2H])n1cc(I)c2c(N)ncnc21 |
| InChI | InChI=1S/C7H7IN4/c1-12-2-4(8)5-6(9)10-3-11-7(5)12/h2-3H,1H3,(H2,9,10,11)/i1D3 |
| InChIKey | VNFSLRASQZPDFQ-FIBGUPNXSA-N |
| XLogP | 1.16 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.08 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|