C14H14IN5O2S — CID 58597194
N-[4-[(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)methyl]phenyl]methanesulfonamide (PubChem CID 58597194) has the molecular formula C14H14IN5O2S and a molecular weight of 443.27 g/mol. Its IUPAC name is N-[4-[(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)methyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 58597194 |
| Molecular Formula | C14H14IN5O2S |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | N-[4-[(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(Cn2cc(I)c3c(N)ncnc32)cc1 |
| InChI | InChI=1S/C14H14IN5O2S/c1-23(21,22)19-10-4-2-9(3-5-10)6-20-7-11(15)12-13(16)17-8-18-14(12)20/h2-5,7-8,19H,6H2,1H3,(H2,16,17,18) |
| InChIKey | ZHIINIVMIPOUEN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|