C19H14IN3S — CID 122221143
7-benzyl-5-iodo-4-phenylsulfanylpyrrolo[2,3-d]pyrimidine (PubChem CID 122221143) has the molecular formula C19H14IN3S and a molecular weight of 443.31 g/mol. Its IUPAC name is 7-benzyl-5-iodo-4-phenylsulfanylpyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-benzyl-5-iodo-4-phenylsulfanylpyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 122221143 |
| Molecular Formula | C19H14IN3S |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 7-benzyl-5-iodo-4-phenylsulfanylpyrrolo[2,3-d]pyrimidine |
| SMILES | Ic1cn(Cc2ccccc2)c2ncnc(Sc3ccccc3)c12 |
| InChI | InChI=1S/C19H14IN3S/c20-16-12-23(11-14-7-3-1-4-8-14)18-17(16)19(22-13-21-18)24-15-9-5-2-6-10-15/h1-10,12-13H,11H2 |
| InChIKey | JMXKSBNEPROHQU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|