About 5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine
5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 134518834) has the molecular formula C9H7IN4
and a molecular weight of 298.09 g/mol. Its IUPAC name is 5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 134518834 |
| Molecular Formula | C9H7IN4 |
| Molecular Weight | 298.09 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | 5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C#CCn1cc(I)c2c(N)ncnc21 |
| InChI | InChI=1S/C9H7IN4/c1-2-3-14-4-6(10)7-8(11)12-5-13-9(7)14/h1,4-5H,3H2,(H2,11,12,13) |
| InChIKey | SCPJXDJEHHSBMS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.09 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of 5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine (CID 134518834) is 5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine is C#CCn1cc(I)c2c(N)ncnc21.
What is the InChIKey of 5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is SCPJXDJEHHSBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7IN4/c1-2-3-14-4-6(10)7-8(11)12-5-13-9(7)14/h1,4-5H,3H2,(H2,11,12,13).
What are the key properties of 5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine?
5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 298.09 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-7-prop-2-ynylpyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 134518834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).