C19H11Cl2I2N7O2 — CID 159886053
4-chloro-5-iodo-7-[(4-nitrophenyl)methyl]pyrrolo[2,3-d]pyrimidine;4-chloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 159886053) has the molecular formula C19H11Cl2I2N7O2 and a molecular weight of 694.06 g/mol. Its IUPAC name is 4-chloro-5-iodo-7-[(4-nitrophenyl)methyl]pyrrolo[2,3-d]pyrimidine;4-chloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-chloro-5-iodo-7-[(4-nitrophenyl)methyl]pyrrolo[2,3-d]pyrimidine;4-chloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 159886053 |
| Molecular Formula | C19H11Cl2I2N7O2 |
| Molecular Weight | 694.06 g/mol |
| Exact Mass | 692.84 |
| IUPAC Name | 4-chloro-5-iodo-7-[(4-nitrophenyl)methyl]pyrrolo[2,3-d]pyrimidine;4-chloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Clc1ncnc2[nH]cc(I)c12.O=[N+]([O-])c1ccc(Cn2cc(I)c3c(Cl)ncnc32)cc1 |
| InChI | InChI=1S/C13H8ClIN4O2.C6H3ClIN3/c14-12-11-10(15)6-18(13(11)17-7-16-12)5-8-1-3-9(4-2-8)19(20)21;7-5-4-3(8)1-9-6(4)11-2-10-5/h1-4,6-7H,5H2;1-2H,(H,9,10,11) |
| InChIKey | NUDOBRDDLITZQO-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.06 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|