C10H15ClN8O2 — CID 161467672
6-chloropyrimidine-2,4-diamine;2-(2,6-diaminopyrimidin-4-yl)oxyethanol (PubChem CID 161467672) has the molecular formula C10H15ClN8O2 and a molecular weight of 314.74 g/mol. Its IUPAC name is 6-chloropyrimidine-2,4-diamine;2-(2,6-diaminopyrimidin-4-yl)oxyethanol.
| Compound Name | 6-chloropyrimidine-2,4-diamine;2-(2,6-diaminopyrimidin-4-yl)oxyethanol |
|---|---|
| PubChem CID | 161467672 |
| Molecular Formula | C10H15ClN8O2 |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 6-chloropyrimidine-2,4-diamine;2-(2,6-diaminopyrimidin-4-yl)oxyethanol |
| SMILES | Nc1cc(Cl)nc(N)n1.Nc1cc(OCCO)nc(N)n1 |
| InChI | InChI=1S/C6H10N4O2.C4H5ClN4/c7-4-3-5(12-2-1-11)10-6(8)9-4;5-2-1-3(6)9-4(7)8-2/h3,11H,1-2H2,(H4,7,8,9,10);1H,(H4,6,7,8,9) |
| InChIKey | WCQTXSICLJWJGK-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 185.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |