C26H24N6Na2O7S2 — CID 161469454
disodium;2-[[4-anilino-6-[ethoxy(methyl)amino]-1,3,5-triazin-2-yl]amino]-6-[2-(2-sulfonatophenyl)ethenyl]benzenesulfonate (PubChem CID 161469454) has the molecular formula C26H24N6Na2O7S2 and a molecular weight of 642.63 g/mol. Its IUPAC name is disodium;2-[[4-anilino-6-[ethoxy(methyl)amino]-1,3,5-triazin-2-yl]amino]-6-[2-(2-sulfonatophenyl)ethenyl]benzenesulfonate.
| Compound Name | disodium;2-[[4-anilino-6-[ethoxy(methyl)amino]-1,3,5-triazin-2-yl]amino]-6-[2-(2-sulfonatophenyl)ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 161469454 |
| Molecular Formula | C26H24N6Na2O7S2 |
| Molecular Weight | 642.63 g/mol |
| Exact Mass | 642.09 |
| IUPAC Name | disodium;2-[[4-anilino-6-[ethoxy(methyl)amino]-1,3,5-triazin-2-yl]amino]-6-[2-(2-sulfonatophenyl)ethenyl]benzenesulfonate |
| SMILES | CCON(C)c1nc(Nc2ccccc2)nc(Nc2cccc(C=Cc3ccccc3S(=O)(=O)[O-])c2S(=O)(=O)[O-])n1.[Na+].[Na+] |
| InChI | InChI=1S/C26H26N6O7S2.2Na/c1-3-39-32(2)26-30-24(27-20-12-5-4-6-13-20)29-25(31-26)28-21-14-9-11-19(23(21)41(36,37)38)17-16-18-10-7-8-15-22(18)40(33,34)35;;/h4-17H,3H2,1-2H3,(H,33,34,35)(H,36,37,38)(H2,27,28,29,30,31);;/q;2*+1/p-2 |
| InChIKey | RLBTXKRDUBOKDS-UHFFFAOYSA-L |
| XLogP | -2.27 |
| TPSA | 189.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.63 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|