C18H30I2O6 — CID 161470423
2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoic acid;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane;molecular iodine (PubChem CID 161470423) has the molecular formula C18H30I2O6 and a molecular weight of 596.24 g/mol. Its IUPAC name is 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoic acid;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane;molecular iodine.
| Compound Name | 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoic acid;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane;molecular iodine |
|---|---|
| PubChem CID | 161470423 |
| Molecular Formula | C18H30I2O6 |
| Molecular Weight | 596.24 g/mol |
| Exact Mass | 596.01 |
| IUPAC Name | 2-(2-methyl-1,3-dioxolan-2-yl)pent-4-enoic acid;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane;molecular iodine |
| SMILES | C=CCC(C(=O)O)C1(C)OCCO1.C=CCC(C)C1(C)OCCO1.II |
| InChI | InChI=1S/C9H14O4.C9H16O2.I2/c1-3-4-7(8(10)11)9(2)12-5-6-13-9;1-4-5-8(2)9(3)10-6-7-11-9;1-2/h3,7H,1,4-6H2,2H3,(H,10,11);4,8H,1,5-7H2,2-3H3; |
| InChIKey | WCZUVMZCGVIIJW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.24 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|