C25H30ClF3N2O4 — CID 161471334
(2S)-2-amino-3-(3-chlorophenyl)-N-[(1S,4S,5S)-6,6,6-trifluoro-5-hydroxy-1-(3-methoxyphenyl)-2-oxo-4-propan-2-ylhexyl]propanamide (PubChem CID 161471334) has the molecular formula C25H30ClF3N2O4 and a molecular weight of 514.97 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-chlorophenyl)-N-[(1S,4S,5S)-6,6,6-trifluoro-5-hydroxy-1-(3-methoxyphenyl)-2-oxo-4-propan-2-ylhexyl]propanamide.
| Compound Name | (2S)-2-amino-3-(3-chlorophenyl)-N-[(1S,4S,5S)-6,6,6-trifluoro-5-hydroxy-1-(3-methoxyphenyl)-2-oxo-4-propan-2-ylhexyl]propanamide |
|---|---|
| PubChem CID | 161471334 |
| Molecular Formula | C25H30ClF3N2O4 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | (2S)-2-amino-3-(3-chlorophenyl)-N-[(1S,4S,5S)-6,6,6-trifluoro-5-hydroxy-1-(3-methoxyphenyl)-2-oxo-4-propan-2-ylhexyl]propanamide |
| SMILES | COc1cccc([C@H](NC(=O)[C@@H](N)Cc2cccc(Cl)c2)C(=O)C[C@@H](C(C)C)[C@H](O)C(F)(F)F)c1 |
| InChI | InChI=1S/C25H30ClF3N2O4/c1-14(2)19(23(33)25(27,28)29)13-21(32)22(16-7-5-9-18(12-16)35-3)31-24(34)20(30)11-15-6-4-8-17(26)10-15/h4-10,12,14,19-20,22-23,33H,11,13,30H2,1-3H3,(H,31,34)/t19-,20-,22-,23-/m0/s1 |
| InChIKey | WDCWLJUYKVFKJZ-SQOUVECCSA-N |
| XLogP | 4.23 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |