C32H39ClF3N3O7 — CID 158691043
tert-butyl N-[2-[[(2S)-3-(3-chlorophenyl)-1-oxo-1-[[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]amino]propan-2-yl]amino]-2-oxoethyl]carbamate (PubChem CID 158691043) has the molecular formula C32H39ClF3N3O7 and a molecular weight of 670.13 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2S)-3-(3-chlorophenyl)-1-oxo-1-[[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]amino]propan-2-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2S)-3-(3-chlorophenyl)-1-oxo-1-[[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]amino]propan-2-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 158691043 |
| Molecular Formula | C32H39ClF3N3O7 |
| Molecular Weight | 670.13 g/mol |
| Exact Mass | 669.24 |
| IUPAC Name | tert-butyl N-[2-[[(2S)-3-(3-chlorophenyl)-1-oxo-1-[[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]amino]propan-2-yl]amino]-2-oxoethyl]carbamate |
| SMILES | COc1ccc([C@H](NC(=O)[C@H](Cc2cccc(Cl)c2)NC(=O)CNC(=O)OC(C)(C)C)C(=O)C[C@H](C(=O)C(F)(F)F)C(C)C)cc1 |
| InChI | InChI=1S/C32H39ClF3N3O7/c1-18(2)23(28(42)32(34,35)36)16-25(40)27(20-10-12-22(45-6)13-11-20)39-29(43)24(15-19-8-7-9-21(33)14-19)38-26(41)17-37-30(44)46-31(3,4)5/h7-14,18,23-24,27H,15-17H2,1-6H3,(H,37,44)(H,38,41)(H,39,43)/t23-,24-,27-/m0/s1 |
| InChIKey | IGISVGJEMWKVCE-DPZBCOQUSA-N |
| XLogP | 5.12 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.13 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |