C29H28ClF5N2O5 — CID 158233758
(2R)-5-(3-chlorophenyl)-2-(cyanomethyl)-5,5-difluoro-4-oxo-N-[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]pentanamide (PubChem CID 158233758) has the molecular formula C29H28ClF5N2O5 and a molecular weight of 615.00 g/mol. Its IUPAC name is (2R)-5-(3-chlorophenyl)-2-(cyanomethyl)-5,5-difluoro-4-oxo-N-[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]pentanamide.
| Compound Name | (2R)-5-(3-chlorophenyl)-2-(cyanomethyl)-5,5-difluoro-4-oxo-N-[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]pentanamide |
|---|---|
| PubChem CID | 158233758 |
| Molecular Formula | C29H28ClF5N2O5 |
| Molecular Weight | 615.00 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | (2R)-5-(3-chlorophenyl)-2-(cyanomethyl)-5,5-difluoro-4-oxo-N-[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]pentanamide |
| SMILES | COc1ccc([C@H](NC(=O)[C@H](CC#N)CC(=O)C(F)(F)c2cccc(Cl)c2)C(=O)C[C@H](C(=O)C(F)(F)F)C(C)C)cc1 |
| InChI | InChI=1S/C29H28ClF5N2O5/c1-16(2)22(26(40)29(33,34)35)15-23(38)25(17-7-9-21(42-3)10-8-17)37-27(41)18(11-12-36)13-24(39)28(31,32)19-5-4-6-20(30)14-19/h4-10,14,16,18,22,25H,11,13,15H2,1-3H3,(H,37,41)/t18-,22+,25+/m1/s1 |
| InChIKey | GERYLIBIWOMZGR-MOADCYBESA-N |
| XLogP | 6.15 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.00 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |