C32H37ClF3NO6 — CID 149479145
(2S)-4-[1-(4-chlorophenyl)cyclopentyl]-2-(hydroxymethyl)-4-oxo-N-[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]butanamide (PubChem CID 149479145) has the molecular formula C32H37ClF3NO6 and a molecular weight of 624.10 g/mol. Its IUPAC name is (2S)-4-[1-(4-chlorophenyl)cyclopentyl]-2-(hydroxymethyl)-4-oxo-N-[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]butanamide.
| Compound Name | (2S)-4-[1-(4-chlorophenyl)cyclopentyl]-2-(hydroxymethyl)-4-oxo-N-[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]butanamide |
|---|---|
| PubChem CID | 149479145 |
| Molecular Formula | C32H37ClF3NO6 |
| Molecular Weight | 624.10 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | (2S)-4-[1-(4-chlorophenyl)cyclopentyl]-2-(hydroxymethyl)-4-oxo-N-[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]butanamide |
| SMILES | COc1ccc([C@H](NC(=O)[C@H](CO)CC(=O)C2(c3ccc(Cl)cc3)CCCC2)C(=O)C[C@H](C(=O)C(F)(F)F)C(C)C)cc1 |
| InChI | InChI=1S/C32H37ClF3NO6/c1-19(2)25(29(41)32(34,35)36)17-26(39)28(20-6-12-24(43-3)13-7-20)37-30(42)21(18-38)16-27(40)31(14-4-5-15-31)22-8-10-23(33)11-9-22/h6-13,19,21,25,28,38H,4-5,14-18H2,1-3H3,(H,37,42)/t21-,25-,28-/m0/s1 |
| InChIKey | ZCXBACLFHKZCJB-QLADTWODSA-N |
| XLogP | 5.95 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.10 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |