C29H32F5N3O7 — CID 158329401
N-[(2S)-1-[[(1S,4S)-6,6-difluoro-1-(4-methoxyphenyl)-2,5,7-trioxo-4-propan-2-yl-7-(2,2,2-trifluoroethylamino)heptyl]amino]-3-hydroxy-1-oxopropan-2-yl]benzamide (PubChem CID 158329401) has the molecular formula C29H32F5N3O7 and a molecular weight of 629.58 g/mol. Its IUPAC name is N-[(2S)-1-[[(1S,4S)-6,6-difluoro-1-(4-methoxyphenyl)-2,5,7-trioxo-4-propan-2-yl-7-(2,2,2-trifluoroethylamino)heptyl]amino]-3-hydroxy-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[[(1S,4S)-6,6-difluoro-1-(4-methoxyphenyl)-2,5,7-trioxo-4-propan-2-yl-7-(2,2,2-trifluoroethylamino)heptyl]amino]-3-hydroxy-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 158329401 |
| Molecular Formula | C29H32F5N3O7 |
| Molecular Weight | 629.58 g/mol |
| Exact Mass | 629.22 |
| IUPAC Name | N-[(2S)-1-[[(1S,4S)-6,6-difluoro-1-(4-methoxyphenyl)-2,5,7-trioxo-4-propan-2-yl-7-(2,2,2-trifluoroethylamino)heptyl]amino]-3-hydroxy-1-oxopropan-2-yl]benzamide |
| SMILES | COc1ccc([C@H](NC(=O)[C@H](CO)NC(=O)c2ccccc2)C(=O)C[C@H](C(=O)C(F)(F)C(=O)NCC(F)(F)F)C(C)C)cc1 |
| InChI | InChI=1S/C29H32F5N3O7/c1-16(2)20(24(40)29(33,34)27(43)35-15-28(30,31)32)13-22(39)23(17-9-11-19(44-3)12-10-17)37-26(42)21(14-38)36-25(41)18-7-5-4-6-8-18/h4-12,16,20-21,23,38H,13-15H2,1-3H3,(H,35,43)(H,36,41)(H,37,42)/t20-,21-,23-/m0/s1 |
| InChIKey | XXTCRSGJDHDSNT-FUDKSRODSA-N |
| XLogP | 2.76 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|