C28H31F5N4O6 — CID 137364870
N-[(2S)-1-[[(1S)-2-[[(3S)-5,5-difluoro-2-methyl-4,6-dioxo-6-(2,2,2-trifluoroethylamino)hexan-3-yl]amino]-1-(4-methoxyphenyl)-2-oxoethyl]amino]-1-oxopropan-2-yl]benzamide (PubChem CID 137364870) has the molecular formula C28H31F5N4O6 and a molecular weight of 614.57 g/mol. Its IUPAC name is N-[(2S)-1-[[(1S)-2-[[(3S)-5,5-difluoro-2-methyl-4,6-dioxo-6-(2,2,2-trifluoroethylamino)hexan-3-yl]amino]-1-(4-methoxyphenyl)-2-oxoethyl]amino]-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[[(1S)-2-[[(3S)-5,5-difluoro-2-methyl-4,6-dioxo-6-(2,2,2-trifluoroethylamino)hexan-3-yl]amino]-1-(4-methoxyphenyl)-2-oxoethyl]amino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 137364870 |
| Molecular Formula | C28H31F5N4O6 |
| Molecular Weight | 614.57 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | N-[(2S)-1-[[(1S)-2-[[(3S)-5,5-difluoro-2-methyl-4,6-dioxo-6-(2,2,2-trifluoroethylamino)hexan-3-yl]amino]-1-(4-methoxyphenyl)-2-oxoethyl]amino]-1-oxopropan-2-yl]benzamide |
| SMILES | COc1ccc([C@H](NC(=O)[C@H](C)NC(=O)c2ccccc2)C(=O)N[C@H](C(=O)C(F)(F)C(=O)NCC(F)(F)F)C(C)C)cc1 |
| InChI | InChI=1S/C28H31F5N4O6/c1-15(2)20(22(38)28(32,33)26(42)34-14-27(29,30)31)36-25(41)21(17-10-12-19(43-4)13-11-17)37-23(39)16(3)35-24(40)18-8-6-5-7-9-18/h5-13,15-16,20-21H,14H2,1-4H3,(H,34,42)(H,35,40)(H,36,41)(H,37,39)/t16-,20-,21-/m0/s1 |
| InChIKey | PTXSOBQFCNCQCT-NDXORKPFSA-N |
| XLogP | 2.69 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|