C33H31Cl3F5N3O6 — CID 138618633
4-[[2-[[2-(3-chlorophenoxy)-3-(3,4-dichlorophenyl)propanoyl]amino]-2-(4-methoxyphenyl)acetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide (PubChem CID 138618633) has the molecular formula C33H31Cl3F5N3O6 and a molecular weight of 766.97 g/mol. Its IUPAC name is 4-[[2-[[2-(3-chlorophenoxy)-3-(3,4-dichlorophenyl)propanoyl]amino]-2-(4-methoxyphenyl)acetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide.
| Compound Name | 4-[[2-[[2-(3-chlorophenoxy)-3-(3,4-dichlorophenyl)propanoyl]amino]-2-(4-methoxyphenyl)acetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
|---|---|
| PubChem CID | 138618633 |
| Molecular Formula | C33H31Cl3F5N3O6 |
| Molecular Weight | 766.97 g/mol |
| Exact Mass | 765.12 |
| IUPAC Name | 4-[[2-[[2-(3-chlorophenoxy)-3-(3,4-dichlorophenyl)propanoyl]amino]-2-(4-methoxyphenyl)acetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
| SMILES | COc1ccc(C(NC(=O)C(Cc2ccc(Cl)c(Cl)c2)Oc2cccc(Cl)c2)C(=O)NC(C(=O)C(F)(F)C(=O)NCC(F)(F)F)C(C)C)cc1 |
| InChI | InChI=1S/C33H31Cl3F5N3O6/c1-17(2)26(28(45)33(40,41)31(48)42-16-32(37,38)39)43-30(47)27(19-8-10-21(49-3)11-9-19)44-29(46)25(50-22-6-4-5-20(34)15-22)14-18-7-12-23(35)24(36)13-18/h4-13,15,17,25-27H,14,16H2,1-3H3,(H,42,48)(H,43,47)(H,44,46) |
| InChIKey | NBJNAHPYQOWXKH-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.97 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|