C26H26Cl2F5N3O4 — CID 122689577
(4S)-4-[[(2S)-2-[3-(3,4-dichlorophenyl)propanoylamino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide (PubChem CID 122689577) has the molecular formula C26H26Cl2F5N3O4 and a molecular weight of 610.41 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-[3-(3,4-dichlorophenyl)propanoylamino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide.
| Compound Name | (4S)-4-[[(2S)-2-[3-(3,4-dichlorophenyl)propanoylamino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
|---|---|
| PubChem CID | 122689577 |
| Molecular Formula | C26H26Cl2F5N3O4 |
| Molecular Weight | 610.41 g/mol |
| Exact Mass | 609.12 |
| IUPAC Name | (4S)-4-[[(2S)-2-[3-(3,4-dichlorophenyl)propanoylamino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](NC(=O)CCc1ccc(Cl)c(Cl)c1)c1ccccc1)C(=O)C(F)(F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C26H26Cl2F5N3O4/c1-14(2)20(22(38)26(32,33)24(40)34-13-25(29,30)31)36-23(39)21(16-6-4-3-5-7-16)35-19(37)11-9-15-8-10-17(27)18(28)12-15/h3-8,10,12,14,20-21H,9,11,13H2,1-2H3,(H,34,40)(H,35,37)(H,36,39)/t20-,21-/m0/s1 |
| InChIKey | QNUPMTPXSSVWMV-SFTDATJTSA-N |
| XLogP | 4.81 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|