C33H32Cl2F5N3O4 — CID 134280757
4-[[2-[[3-(3,4-dichlorophenyl)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide (PubChem CID 134280757) has the molecular formula C33H32Cl2F5N3O4 and a molecular weight of 700.53 g/mol. Its IUPAC name is 4-[[2-[[3-(3,4-dichlorophenyl)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide.
| Compound Name | 4-[[2-[[3-(3,4-dichlorophenyl)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
|---|---|
| PubChem CID | 134280757 |
| Molecular Formula | C33H32Cl2F5N3O4 |
| Molecular Weight | 700.53 g/mol |
| Exact Mass | 699.17 |
| IUPAC Name | 4-[[2-[[3-(3,4-dichlorophenyl)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
| SMILES | CC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)CC(c1ccccc1)c1ccc(Cl)c(Cl)c1)C(=O)C(F)(F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C33H32Cl2F5N3O4/c1-19(2)28(29(45)33(39,40)31(47)41-18-32(36,37)38)43-30(46)26(15-20-9-5-3-6-10-20)42-27(44)17-23(21-11-7-4-8-12-21)22-13-14-24(34)25(35)16-22/h3-14,16,19,23,26,28H,15,17-18H2,1-2H3,(H,41,47)(H,42,44)(H,43,46) |
| InChIKey | TYHOLAGNAQGXAL-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|