C26H29Cl2F2N3O5 — CID 122689601
4-[[2-[[2-(3,5-dichlorophenoxy)acetyl]amino]-3-phenylpropanoyl]amino]-N-ethyl-2,2-difluoro-5-methyl-3-oxohexanamide (PubChem CID 122689601) has the molecular formula C26H29Cl2F2N3O5 and a molecular weight of 572.44 g/mol. Its IUPAC name is 4-[[2-[[2-(3,5-dichlorophenoxy)acetyl]amino]-3-phenylpropanoyl]amino]-N-ethyl-2,2-difluoro-5-methyl-3-oxohexanamide.
| Compound Name | 4-[[2-[[2-(3,5-dichlorophenoxy)acetyl]amino]-3-phenylpropanoyl]amino]-N-ethyl-2,2-difluoro-5-methyl-3-oxohexanamide |
|---|---|
| PubChem CID | 122689601 |
| Molecular Formula | C26H29Cl2F2N3O5 |
| Molecular Weight | 572.44 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | 4-[[2-[[2-(3,5-dichlorophenoxy)acetyl]amino]-3-phenylpropanoyl]amino]-N-ethyl-2,2-difluoro-5-methyl-3-oxohexanamide |
| SMILES | CCNC(=O)C(F)(F)C(=O)C(NC(=O)C(Cc1ccccc1)NC(=O)COc1cc(Cl)cc(Cl)c1)C(C)C |
| InChI | InChI=1S/C26H29Cl2F2N3O5/c1-4-31-25(37)26(29,30)23(35)22(15(2)3)33-24(36)20(10-16-8-6-5-7-9-16)32-21(34)14-38-19-12-17(27)11-18(28)13-19/h5-9,11-13,15,20,22H,4,10,14H2,1-3H3,(H,31,37)(H,32,34)(H,33,36) |
| InChIKey | LWJWGQDXBHOOHZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|