C32H34ClF2N3O5 — CID 122689509
4-[[2-[[2-(3-chlorophenoxy)acetyl]amino]-3-phenylpropanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2-phenylethyl)hexanamide (PubChem CID 122689509) has the molecular formula C32H34ClF2N3O5 and a molecular weight of 614.09 g/mol. Its IUPAC name is 4-[[2-[[2-(3-chlorophenoxy)acetyl]amino]-3-phenylpropanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2-phenylethyl)hexanamide.
| Compound Name | 4-[[2-[[2-(3-chlorophenoxy)acetyl]amino]-3-phenylpropanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2-phenylethyl)hexanamide |
|---|---|
| PubChem CID | 122689509 |
| Molecular Formula | C32H34ClF2N3O5 |
| Molecular Weight | 614.09 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | 4-[[2-[[2-(3-chlorophenoxy)acetyl]amino]-3-phenylpropanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2-phenylethyl)hexanamide |
| SMILES | CC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)COc1cccc(Cl)c1)C(=O)C(F)(F)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C32H34ClF2N3O5/c1-21(2)28(29(40)32(34,35)31(42)36-17-16-22-10-5-3-6-11-22)38-30(41)26(18-23-12-7-4-8-13-23)37-27(39)20-43-25-15-9-14-24(33)19-25/h3-15,19,21,26,28H,16-18,20H2,1-2H3,(H,36,42)(H,37,39)(H,38,41) |
| InChIKey | FZDVLSHKYNHMNL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.09 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|