C27H27Cl3F5N3O5 — CID 146569261
(4S)-4-[[3-(4-chlorophenyl)-2-[[2-(3,5-dichlorophenoxy)acetyl]amino]propanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(3,3,3-trifluoropropyl)hexanamide (PubChem CID 146569261) has the molecular formula C27H27Cl3F5N3O5 and a molecular weight of 674.88 g/mol. Its IUPAC name is (4S)-4-[[3-(4-chlorophenyl)-2-[[2-(3,5-dichlorophenoxy)acetyl]amino]propanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(3,3,3-trifluoropropyl)hexanamide.
| Compound Name | (4S)-4-[[3-(4-chlorophenyl)-2-[[2-(3,5-dichlorophenoxy)acetyl]amino]propanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(3,3,3-trifluoropropyl)hexanamide |
|---|---|
| PubChem CID | 146569261 |
| Molecular Formula | C27H27Cl3F5N3O5 |
| Molecular Weight | 674.88 g/mol |
| Exact Mass | 673.09 |
| IUPAC Name | (4S)-4-[[3-(4-chlorophenyl)-2-[[2-(3,5-dichlorophenoxy)acetyl]amino]propanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(3,3,3-trifluoropropyl)hexanamide |
| SMILES | CC(C)[C@H](NC(=O)C(Cc1ccc(Cl)cc1)NC(=O)COc1cc(Cl)cc(Cl)c1)C(=O)C(F)(F)C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C27H27Cl3F5N3O5/c1-14(2)22(23(40)27(34,35)25(42)36-8-7-26(31,32)33)38-24(41)20(9-15-3-5-16(28)6-4-15)37-21(39)13-43-19-11-17(29)10-18(30)12-19/h3-6,10-12,14,20,22H,7-9,13H2,1-2H3,(H,36,42)(H,37,39)(H,38,41)/t20?,22-/m0/s1 |
| InChIKey | KUAGBXHUCCMOHG-IAXKEJLGSA-N |
| XLogP | 5.17 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.88 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|