C28H28Cl3F5N2O5 — CID 147541700
(4S,7S)-8-(4-chlorophenyl)-7-[[2-(3,5-dichlorophenoxy)acetyl]amino]-2,2-difluoro-3,6-dioxo-4-propan-2-yl-N-(3,3,3-trifluoropropyl)octanamide (PubChem CID 147541700) has the molecular formula C28H28Cl3F5N2O5 and a molecular weight of 673.89 g/mol. Its IUPAC name is (4S,7S)-8-(4-chlorophenyl)-7-[[2-(3,5-dichlorophenoxy)acetyl]amino]-2,2-difluoro-3,6-dioxo-4-propan-2-yl-N-(3,3,3-trifluoropropyl)octanamide.
| Compound Name | (4S,7S)-8-(4-chlorophenyl)-7-[[2-(3,5-dichlorophenoxy)acetyl]amino]-2,2-difluoro-3,6-dioxo-4-propan-2-yl-N-(3,3,3-trifluoropropyl)octanamide |
|---|---|
| PubChem CID | 147541700 |
| Molecular Formula | C28H28Cl3F5N2O5 |
| Molecular Weight | 673.89 g/mol |
| Exact Mass | 672.10 |
| IUPAC Name | (4S,7S)-8-(4-chlorophenyl)-7-[[2-(3,5-dichlorophenoxy)acetyl]amino]-2,2-difluoro-3,6-dioxo-4-propan-2-yl-N-(3,3,3-trifluoropropyl)octanamide |
| SMILES | CC(C)[C@H](CC(=O)[C@H](Cc1ccc(Cl)cc1)NC(=O)COc1cc(Cl)cc(Cl)c1)C(=O)C(F)(F)C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C28H28Cl3F5N2O5/c1-15(2)21(25(41)28(35,36)26(42)37-8-7-27(32,33)34)13-23(39)22(9-16-3-5-17(29)6-4-16)38-24(40)14-43-20-11-18(30)10-19(31)12-20/h3-6,10-12,15,21-22H,7-9,13-14H2,1-2H3,(H,37,42)(H,38,40)/t21-,22-/m0/s1 |
| InChIKey | FPAQTMSZXVNLMC-VXKWHMMOSA-N |
| XLogP | 6.26 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.89 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|