C26H26Cl4F5N3O4 — CID 146500828
(4S,6S)-5-amino-6-[[2-(3,5-dichlorophenoxy)acetyl]amino]-7-(3,4-dichlorophenyl)-2,2-difluoro-3-oxo-4-propan-2-yl-N-(2,2,2-trifluoroethyl)heptanamide (PubChem CID 146500828) has the molecular formula C26H26Cl4F5N3O4 and a molecular weight of 681.31 g/mol. Its IUPAC name is (4S,6S)-5-amino-6-[[2-(3,5-dichlorophenoxy)acetyl]amino]-7-(3,4-dichlorophenyl)-2,2-difluoro-3-oxo-4-propan-2-yl-N-(2,2,2-trifluoroethyl)heptanamide.
| Compound Name | (4S,6S)-5-amino-6-[[2-(3,5-dichlorophenoxy)acetyl]amino]-7-(3,4-dichlorophenyl)-2,2-difluoro-3-oxo-4-propan-2-yl-N-(2,2,2-trifluoroethyl)heptanamide |
|---|---|
| PubChem CID | 146500828 |
| Molecular Formula | C26H26Cl4F5N3O4 |
| Molecular Weight | 681.31 g/mol |
| Exact Mass | 679.06 |
| IUPAC Name | (4S,6S)-5-amino-6-[[2-(3,5-dichlorophenoxy)acetyl]amino]-7-(3,4-dichlorophenyl)-2,2-difluoro-3-oxo-4-propan-2-yl-N-(2,2,2-trifluoroethyl)heptanamide |
| SMILES | CC(C)[C@H](C(=O)C(F)(F)C(=O)NCC(F)(F)F)C(N)[C@H](Cc1ccc(Cl)c(Cl)c1)NC(=O)COc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C26H26Cl4F5N3O4/c1-12(2)21(23(40)26(34,35)24(41)37-11-25(31,32)33)22(36)19(6-13-3-4-17(29)18(30)5-13)38-20(39)10-42-16-8-14(27)7-15(28)9-16/h3-5,7-9,12,19,21-22H,6,10-11,36H2,1-2H3,(H,37,41)(H,38,39)/t19-,21-,22?/m0/s1 |
| InChIKey | SKYHDUCSJZODLP-QUCQDJGISA-N |
| XLogP | 5.89 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.31 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|