C27H32Cl2F5N3O2 — CID 146500827
(4S,6S)-5,7-diamino-6-benzyl-9-(3,4-dichlorophenyl)-2,2-difluoro-3-oxo-4-propan-2-yl-N-(2,2,2-trifluoroethyl)nonanamide (PubChem CID 146500827) has the molecular formula C27H32Cl2F5N3O2 and a molecular weight of 596.47 g/mol. Its IUPAC name is (4S,6S)-5,7-diamino-6-benzyl-9-(3,4-dichlorophenyl)-2,2-difluoro-3-oxo-4-propan-2-yl-N-(2,2,2-trifluoroethyl)nonanamide.
| Compound Name | (4S,6S)-5,7-diamino-6-benzyl-9-(3,4-dichlorophenyl)-2,2-difluoro-3-oxo-4-propan-2-yl-N-(2,2,2-trifluoroethyl)nonanamide |
|---|---|
| PubChem CID | 146500827 |
| Molecular Formula | C27H32Cl2F5N3O2 |
| Molecular Weight | 596.47 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | (4S,6S)-5,7-diamino-6-benzyl-9-(3,4-dichlorophenyl)-2,2-difluoro-3-oxo-4-propan-2-yl-N-(2,2,2-trifluoroethyl)nonanamide |
| SMILES | CC(C)[C@H](C(=O)C(F)(F)C(=O)NCC(F)(F)F)C(N)[C@@H](Cc1ccccc1)C(N)CCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H32Cl2F5N3O2/c1-15(2)22(24(38)27(33,34)25(39)37-14-26(30,31)32)23(36)18(12-16-6-4-3-5-7-16)21(35)11-9-17-8-10-19(28)20(29)13-17/h3-8,10,13,15,18,21-23H,9,11-12,14,35-36H2,1-2H3,(H,37,39)/t18-,21?,22-,23?/m0/s1 |
| InChIKey | LBJVMXVSJQUJDM-NNFZLKSESA-N |
| XLogP | 5.59 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|