C32H31Cl3F5N3O3 — CID 146500807
(4S)-4-[[(2S)-3-amino-2-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-5-phenylpentanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide (PubChem CID 146500807) has the molecular formula C32H31Cl3F5N3O3 and a molecular weight of 706.97 g/mol. Its IUPAC name is (4S)-4-[[(2S)-3-amino-2-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-5-phenylpentanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide.
| Compound Name | (4S)-4-[[(2S)-3-amino-2-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-5-phenylpentanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
|---|---|
| PubChem CID | 146500807 |
| Molecular Formula | C32H31Cl3F5N3O3 |
| Molecular Weight | 706.97 g/mol |
| Exact Mass | 705.14 |
| IUPAC Name | (4S)-4-[[(2S)-3-amino-2-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-5-phenylpentanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](c1ccc(Cl)cc1)C(N)CC(c1ccccc1)c1ccc(Cl)c(Cl)c1)C(=O)C(F)(F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C32H31Cl3F5N3O3/c1-17(2)27(28(44)32(39,40)30(46)42-16-31(36,37)38)43-29(45)26(19-8-11-21(33)12-9-19)25(41)15-22(18-6-4-3-5-7-18)20-10-13-23(34)24(35)14-20/h3-14,17,22,25-27H,15-16,41H2,1-2H3,(H,42,46)(H,43,45)/t22?,25?,26-,27-/m0/s1 |
| InChIKey | OVMUPIQKCOEUIU-PLLYQWAOSA-N |
| XLogP | 7.30 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.97 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|