C32H30Cl2F5N3O4 — CID 122689454
4-[[2-[[3-(3,5-dichlorophenyl)-3-phenylpropanoyl]amino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide (PubChem CID 122689454) has the molecular formula C32H30Cl2F5N3O4 and a molecular weight of 686.51 g/mol. Its IUPAC name is 4-[[2-[[3-(3,5-dichlorophenyl)-3-phenylpropanoyl]amino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide.
| Compound Name | 4-[[2-[[3-(3,5-dichlorophenyl)-3-phenylpropanoyl]amino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
|---|---|
| PubChem CID | 122689454 |
| Molecular Formula | C32H30Cl2F5N3O4 |
| Molecular Weight | 686.51 g/mol |
| Exact Mass | 685.15 |
| IUPAC Name | 4-[[2-[[3-(3,5-dichlorophenyl)-3-phenylpropanoyl]amino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
| SMILES | CC(C)C(NC(=O)C(NC(=O)CC(c1ccccc1)c1cc(Cl)cc(Cl)c1)c1ccccc1)C(=O)C(F)(F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C32H30Cl2F5N3O4/c1-18(2)26(28(44)32(38,39)30(46)40-17-31(35,36)37)42-29(45)27(20-11-7-4-8-12-20)41-25(43)16-24(19-9-5-3-6-10-19)21-13-22(33)15-23(34)14-21/h3-15,18,24,26-27H,16-17H2,1-2H3,(H,40,46)(H,41,43)(H,42,45) |
| InChIKey | MJUCJELYDLUTID-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|