C32H31Cl3F5N3O4 — CID 166728473
(4S)-4-[[(2S,4S)-3-amino-5-(3-chlorophenyl)-4-(3,5-dichlorophenoxy)-2-phenylpentanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide (PubChem CID 166728473) has the molecular formula C32H31Cl3F5N3O4 and a molecular weight of 722.97 g/mol. Its IUPAC name is (4S)-4-[[(2S,4S)-3-amino-5-(3-chlorophenyl)-4-(3,5-dichlorophenoxy)-2-phenylpentanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide.
| Compound Name | (4S)-4-[[(2S,4S)-3-amino-5-(3-chlorophenyl)-4-(3,5-dichlorophenoxy)-2-phenylpentanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
|---|---|
| PubChem CID | 166728473 |
| Molecular Formula | C32H31Cl3F5N3O4 |
| Molecular Weight | 722.97 g/mol |
| Exact Mass | 721.13 |
| IUPAC Name | (4S)-4-[[(2S,4S)-3-amino-5-(3-chlorophenyl)-4-(3,5-dichlorophenoxy)-2-phenylpentanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](c1ccccc1)C(N)[C@H](Cc1cccc(Cl)c1)Oc1cc(Cl)cc(Cl)c1)C(=O)C(F)(F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C32H31Cl3F5N3O4/c1-17(2)27(28(44)32(39,40)30(46)42-16-31(36,37)38)43-29(45)25(19-8-4-3-5-9-19)26(41)24(12-18-7-6-10-20(33)11-18)47-23-14-21(34)13-22(35)15-23/h3-11,13-15,17,24-27H,12,16,41H2,1-2H3,(H,42,46)(H,43,45)/t24-,25-,26?,27-/m0/s1 |
| InChIKey | PJNFVDZLWQFMIQ-DUNLCCOXSA-N |
| XLogP | 6.77 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.97 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|