C27H28Cl2F5N3O5 — CID 122689653
(4S)-4-[[(2S)-2-[[2-(3,5-dichlorophenoxy)acetyl]amino]-3-phenylpropanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(3,3,3-trifluoropropyl)hexanamide (PubChem CID 122689653) has the molecular formula C27H28Cl2F5N3O5 and a molecular weight of 640.43 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-[[2-(3,5-dichlorophenoxy)acetyl]amino]-3-phenylpropanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(3,3,3-trifluoropropyl)hexanamide.
| Compound Name | (4S)-4-[[(2S)-2-[[2-(3,5-dichlorophenoxy)acetyl]amino]-3-phenylpropanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(3,3,3-trifluoropropyl)hexanamide |
|---|---|
| PubChem CID | 122689653 |
| Molecular Formula | C27H28Cl2F5N3O5 |
| Molecular Weight | 640.43 g/mol |
| Exact Mass | 639.13 |
| IUPAC Name | (4S)-4-[[(2S)-2-[[2-(3,5-dichlorophenoxy)acetyl]amino]-3-phenylpropanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(3,3,3-trifluoropropyl)hexanamide |
| SMILES | CC(C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)COc1cc(Cl)cc(Cl)c1)C(=O)C(F)(F)C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C27H28Cl2F5N3O5/c1-15(2)22(23(39)27(33,34)25(41)35-9-8-26(30,31)32)37-24(40)20(10-16-6-4-3-5-7-16)36-21(38)14-42-19-12-17(28)11-18(29)13-19/h3-7,11-13,15,20,22H,8-10,14H2,1-2H3,(H,35,41)(H,36,38)(H,37,40)/t20-,22-/m0/s1 |
| InChIKey | WREJIUJSTDFJAX-UNMCSNQZSA-N |
| XLogP | 4.51 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|