C29H32Cl2F5N3O7 — CID 122689671
(4S)-4-[[(2S)-2-[[2-(3,5-dichlorophenoxy)acetyl]amino]-3-(3,4-dimethoxyphenyl)propanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(3,3,3-trifluoropropyl)hexanamide (PubChem CID 122689671) has the molecular formula C29H32Cl2F5N3O7 and a molecular weight of 700.48 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-[[2-(3,5-dichlorophenoxy)acetyl]amino]-3-(3,4-dimethoxyphenyl)propanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(3,3,3-trifluoropropyl)hexanamide.
| Compound Name | (4S)-4-[[(2S)-2-[[2-(3,5-dichlorophenoxy)acetyl]amino]-3-(3,4-dimethoxyphenyl)propanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(3,3,3-trifluoropropyl)hexanamide |
|---|---|
| PubChem CID | 122689671 |
| Molecular Formula | C29H32Cl2F5N3O7 |
| Molecular Weight | 700.48 g/mol |
| Exact Mass | 699.15 |
| IUPAC Name | (4S)-4-[[(2S)-2-[[2-(3,5-dichlorophenoxy)acetyl]amino]-3-(3,4-dimethoxyphenyl)propanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(3,3,3-trifluoropropyl)hexanamide |
| SMILES | COc1ccc(C[C@H](NC(=O)COc2cc(Cl)cc(Cl)c2)C(=O)N[C@H](C(=O)C(F)(F)C(=O)NCCC(F)(F)F)C(C)C)cc1OC |
| InChI | InChI=1S/C29H32Cl2F5N3O7/c1-15(2)24(25(41)29(35,36)27(43)37-8-7-28(32,33)34)39-26(42)20(9-16-5-6-21(44-3)22(10-16)45-4)38-23(40)14-46-19-12-17(30)11-18(31)13-19/h5-6,10-13,15,20,24H,7-9,14H2,1-4H3,(H,37,43)(H,38,40)(H,39,42)/t20-,24-/m0/s1 |
| InChIKey | PIMZUSNINYFWLT-RDPSFJRHSA-N |
| XLogP | 4.53 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|