C28H30Cl2F5N3O5 — CID 122689592
(4S)-4-[[(2S)-2-[3-(3,4-dichlorophenyl)propanoylamino]-3-(4-methoxyphenyl)propanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide (PubChem CID 122689592) has the molecular formula C28H30Cl2F5N3O5 and a molecular weight of 654.46 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-[3-(3,4-dichlorophenyl)propanoylamino]-3-(4-methoxyphenyl)propanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide.
| Compound Name | (4S)-4-[[(2S)-2-[3-(3,4-dichlorophenyl)propanoylamino]-3-(4-methoxyphenyl)propanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
|---|---|
| PubChem CID | 122689592 |
| Molecular Formula | C28H30Cl2F5N3O5 |
| Molecular Weight | 654.46 g/mol |
| Exact Mass | 653.15 |
| IUPAC Name | (4S)-4-[[(2S)-2-[3-(3,4-dichlorophenyl)propanoylamino]-3-(4-methoxyphenyl)propanoyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
| SMILES | COc1ccc(C[C@H](NC(=O)CCc2ccc(Cl)c(Cl)c2)C(=O)N[C@H](C(=O)C(F)(F)C(=O)NCC(F)(F)F)C(C)C)cc1 |
| InChI | InChI=1S/C28H30Cl2F5N3O5/c1-15(2)23(24(40)28(34,35)26(42)36-14-27(31,32)33)38-25(41)21(13-17-4-8-18(43-3)9-5-17)37-22(39)11-7-16-6-10-19(29)20(30)12-16/h4-6,8-10,12,15,21,23H,7,11,13-14H2,1-3H3,(H,36,42)(H,37,39)(H,38,41)/t21-,23-/m0/s1 |
| InChIKey | YJDQIXGYBAWWQU-GMAHTHKFSA-N |
| XLogP | 4.69 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|