C27H25Cl2F5N2O4 — CID 162043982
(4S,7S)-7-[[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]amino]-2,2-difluoro-3,6-dioxo-7-phenyl-4-propan-2-yl-N-(2,2,2-trifluoroethyl)heptanamide (PubChem CID 162043982) has the molecular formula C27H25Cl2F5N2O4 and a molecular weight of 607.40 g/mol. Its IUPAC name is (4S,7S)-7-[[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]amino]-2,2-difluoro-3,6-dioxo-7-phenyl-4-propan-2-yl-N-(2,2,2-trifluoroethyl)heptanamide.
| Compound Name | (4S,7S)-7-[[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]amino]-2,2-difluoro-3,6-dioxo-7-phenyl-4-propan-2-yl-N-(2,2,2-trifluoroethyl)heptanamide |
|---|---|
| PubChem CID | 162043982 |
| Molecular Formula | C27H25Cl2F5N2O4 |
| Molecular Weight | 607.40 g/mol |
| Exact Mass | 606.11 |
| IUPAC Name | (4S,7S)-7-[[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]amino]-2,2-difluoro-3,6-dioxo-7-phenyl-4-propan-2-yl-N-(2,2,2-trifluoroethyl)heptanamide |
| SMILES | CC(C)[C@H](CC(=O)[C@@H](NC(=O)/C=C/c1cc(Cl)cc(Cl)c1)c1ccccc1)C(=O)C(F)(F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C27H25Cl2F5N2O4/c1-15(2)20(24(39)27(33,34)25(40)35-14-26(30,31)32)13-21(37)23(17-6-4-3-5-7-17)36-22(38)9-8-16-10-18(28)12-19(29)11-16/h3-12,15,20,23H,13-14H2,1-2H3,(H,35,40)(H,36,38)/b9-8+/t20-,23-/m0/s1 |
| InChIKey | YXQLXXFEDWUBLN-WWQISKJESA-N |
| XLogP | 5.98 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.40 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|