C23H21Cl3F3NO4 — CID 159036191
N-[(1S,4S)-1-(4-chlorophenyl)-6,6,6-trifluoro-2,5-dioxo-4-propan-2-ylhexyl]-2-(3,5-dichlorophenoxy)acetamide (PubChem CID 159036191) has the molecular formula C23H21Cl3F3NO4 and a molecular weight of 538.78 g/mol. Its IUPAC name is N-[(1S,4S)-1-(4-chlorophenyl)-6,6,6-trifluoro-2,5-dioxo-4-propan-2-ylhexyl]-2-(3,5-dichlorophenoxy)acetamide.
| Compound Name | N-[(1S,4S)-1-(4-chlorophenyl)-6,6,6-trifluoro-2,5-dioxo-4-propan-2-ylhexyl]-2-(3,5-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 159036191 |
| Molecular Formula | C23H21Cl3F3NO4 |
| Molecular Weight | 538.78 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | N-[(1S,4S)-1-(4-chlorophenyl)-6,6,6-trifluoro-2,5-dioxo-4-propan-2-ylhexyl]-2-(3,5-dichlorophenoxy)acetamide |
| SMILES | CC(C)[C@H](CC(=O)[C@@H](NC(=O)COc1cc(Cl)cc(Cl)c1)c1ccc(Cl)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C23H21Cl3F3NO4/c1-12(2)18(22(33)23(27,28)29)10-19(31)21(13-3-5-14(24)6-4-13)30-20(32)11-34-17-8-15(25)7-16(26)9-17/h3-9,12,18,21H,10-11H2,1-2H3,(H,30,32)/t18-,21-/m0/s1 |
| InChIKey | JVMHHJYTTMGCJL-RXVVDRJESA-N |
| XLogP | 6.25 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.78 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |