C31H37ClF3NO5 — CID 159565340
(2R,5S)-5-(4-chlorophenyl)-2,6-dimethyl-4-oxo-N-[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]heptanamide (PubChem CID 159565340) has the molecular formula C31H37ClF3NO5 and a molecular weight of 596.09 g/mol. Its IUPAC name is (2R,5S)-5-(4-chlorophenyl)-2,6-dimethyl-4-oxo-N-[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]heptanamide.
| Compound Name | (2R,5S)-5-(4-chlorophenyl)-2,6-dimethyl-4-oxo-N-[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]heptanamide |
|---|---|
| PubChem CID | 159565340 |
| Molecular Formula | C31H37ClF3NO5 |
| Molecular Weight | 596.09 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | (2R,5S)-5-(4-chlorophenyl)-2,6-dimethyl-4-oxo-N-[(1S,4S)-6,6,6-trifluoro-1-(4-methoxyphenyl)-2,5-dioxo-4-propan-2-ylhexyl]heptanamide |
| SMILES | COc1ccc([C@H](NC(=O)[C@H](C)CC(=O)[C@H](c2ccc(Cl)cc2)C(C)C)C(=O)C[C@H](C(=O)C(F)(F)F)C(C)C)cc1 |
| InChI | InChI=1S/C31H37ClF3NO5/c1-17(2)24(29(39)31(33,34)35)16-26(38)28(21-9-13-23(41-6)14-10-21)36-30(40)19(5)15-25(37)27(18(3)4)20-7-11-22(32)12-8-20/h7-14,17-19,24,27-28H,15-16H2,1-6H3,(H,36,40)/t19-,24+,27+,28+/m1/s1 |
| InChIKey | MHCXPXVXYXJVBH-YJFRUDADSA-N |
| XLogP | 6.90 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.09 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |