C43H68O10 — CID 161471446
(3,3-dihydroxy-2,2-dimethylpropyl) 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate;[2-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylpropyl] 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate (PubChem CID 161471446) has the molecular formula C43H68O10 and a molecular weight of 745.01 g/mol. Its IUPAC name is (3,3-dihydroxy-2,2-dimethylpropyl) 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate;[2-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylpropyl] 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate.
| Compound Name | (3,3-dihydroxy-2,2-dimethylpropyl) 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate;[2-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylpropyl] 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
|---|---|
| PubChem CID | 161471446 |
| Molecular Formula | C43H68O10 |
| Molecular Weight | 745.01 g/mol |
| Exact Mass | 744.48 |
| IUPAC Name | (3,3-dihydroxy-2,2-dimethylpropyl) 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate;[2-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylpropyl] 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
| SMILES | Cc1cc(CCC(=O)OCC(C)(C)C(O)O)cc(C(C)(C)C)c1O.Cc1cc(CCC(=O)OCC(C)(C)C2OCC(C)(C)CO2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H38O5.C19H30O5/c1-16-11-17(12-18(20(16)26)22(2,3)4)9-10-19(25)27-15-24(7,8)21-28-13-23(5,6)14-29-21;1-12-9-13(10-14(16(12)21)18(2,3)4)7-8-15(20)24-11-19(5,6)17(22)23/h11-12,21,26H,9-10,13-15H2,1-8H3;9-10,17,21-23H,7-8,11H2,1-6H3 |
| InChIKey | WDDGEYASHJTESU-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.01 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|