C21H31ClO5 — CID 58827642
[2-chloro-2-(1,3-dioxan-2-yl)propyl] 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate (PubChem CID 58827642) has the molecular formula C21H31ClO5 and a molecular weight of 398.93 g/mol. Its IUPAC name is [2-chloro-2-(1,3-dioxan-2-yl)propyl] 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate.
| Compound Name | [2-chloro-2-(1,3-dioxan-2-yl)propyl] 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
|---|---|
| PubChem CID | 58827642 |
| Molecular Formula | C21H31ClO5 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [2-chloro-2-(1,3-dioxan-2-yl)propyl] 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
| SMILES | Cc1cc(CCC(=O)OCC(C)(Cl)C2OCCCO2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H31ClO5/c1-14-11-15(12-16(18(14)24)20(2,3)4)7-8-17(23)27-13-21(5,22)19-25-9-6-10-26-19/h11-12,19,24H,6-10,13H2,1-5H3 |
| InChIKey | MMURZBFJNCVTPY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|