About 1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride
1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride (PubChem CID 161477186) has the molecular formula C15H11Cl2NS2
and a molecular weight of 340.30 g/mol. Its IUPAC name is 1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride.
Molecular Properties
| Compound Name | 1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride |
| PubChem CID | 161477186 |
| Molecular Formula | C15H11Cl2NS2 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride |
| SMILES | S=C(Cl)Cl.S=C=Nc1ccc(C2CC2)c2ccccc12 |
| InChI | InChI=1S/C14H11NS.CCl2S/c16-9-15-14-8-7-11(10-5-6-10)12-3-1-2-4-13(12)14;2-1(3)4/h1-4,7-8,10H,5-6H2; |
| InChIKey | WDWGUXICDCZIID-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride?
The IUPAC name of 1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride (CID 161477186) is 1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride.
What is the SMILES notation for 1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride?
The canonical SMILES for 1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride is S=C(Cl)Cl.S=C=Nc1ccc(C2CC2)c2ccccc12.
What is the InChIKey of 1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride?
The InChIKey is WDWGUXICDCZIID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NS.CCl2S/c16-9-15-14-8-7-11(10-5-6-10)12-3-1-2-4-13(12)14;2-1(3)4/h1-4,7-8,10H,5-6H2;.
What are the key properties of 1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride?
1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride has a molecular weight of 340.30 g/mol, XLogP of 6.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-4-isothiocyanatonaphthalene;thiocarbonyl dichloride is sourced from PubChem (CID 161477186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).