C24H42O4 — CID 161477638
ethyl (2E)-4,4,5-trimethylhepta-2,6-dienoate;ethyl 4,4,5-trimethylhept-6-enoate (PubChem CID 161477638) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is ethyl (2E)-4,4,5-trimethylhepta-2,6-dienoate;ethyl 4,4,5-trimethylhept-6-enoate.
| Compound Name | ethyl (2E)-4,4,5-trimethylhepta-2,6-dienoate;ethyl 4,4,5-trimethylhept-6-enoate |
|---|---|
| PubChem CID | 161477638 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | ethyl (2E)-4,4,5-trimethylhepta-2,6-dienoate;ethyl 4,4,5-trimethylhept-6-enoate |
| SMILES | C=CC(C)C(C)(C)/C=C/C(=O)OCC.C=CC(C)C(C)(C)CCC(=O)OCC |
| InChI | InChI=1S/C12H22O2.C12H20O2/c2*1-6-10(3)12(4,5)9-8-11(13)14-7-2/h6,10H,1,7-9H2,2-5H3;6,8-10H,1,7H2,2-5H3/b;9-8+ |
| InChIKey | WDXRULDBEZMPNJ-RJDPJKJLSA-N |
| XLogP | 6.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|