C26H46O4 — CID 161219810
bis(2-ethylhexyl) (7E)-7-ethylideneoct-3-enedioate (PubChem CID 161219810) has the molecular formula C26H46O4 and a molecular weight of 422.65 g/mol. Its IUPAC name is bis(2-ethylhexyl) (7E)-7-ethylideneoct-3-enedioate.
| Compound Name | bis(2-ethylhexyl) (7E)-7-ethylideneoct-3-enedioate |
|---|---|
| PubChem CID | 161219810 |
| Molecular Formula | C26H46O4 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | bis(2-ethylhexyl) (7E)-7-ethylideneoct-3-enedioate |
| SMILES | C/C=C(\CCC=CCC(=O)OCC(CC)CCCC)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C26H46O4/c1-6-11-16-22(8-3)20-29-25(27)19-15-13-14-18-24(10-5)26(28)30-21-23(9-4)17-12-7-2/h10,13,15,22-23H,6-9,11-12,14,16-21H2,1-5H3/b15-13?,24-10+ |
| InChIKey | UXIYKNUVOZCTIW-GLGQZHPNSA-N |
| XLogP | 7.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|