About phenol;2-phenoxy-1-phenylethanone
phenol;2-phenoxy-1-phenylethanone (PubChem CID 161484281) has the molecular formula C20H18O3
and a molecular weight of 306.36 g/mol. Its IUPAC name is phenol;2-phenoxy-1-phenylethanone.
Molecular Properties
| Compound Name | phenol;2-phenoxy-1-phenylethanone |
| PubChem CID | 161484281 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | phenol;2-phenoxy-1-phenylethanone |
| SMILES | O=C(COc1ccccc1)c1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C14H12O2.C6H6O/c15-14(12-7-3-1-4-8-12)11-16-13-9-5-2-6-10-13;7-6-4-2-1-3-5-6/h1-10H,11H2;1-5,7H |
| InChIKey | WETSDMJFTRZKLN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenol;2-phenoxy-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;2-phenoxy-1-phenylethanone?
The IUPAC name of phenol;2-phenoxy-1-phenylethanone (CID 161484281) is phenol;2-phenoxy-1-phenylethanone.
What is the SMILES notation for phenol;2-phenoxy-1-phenylethanone?
The canonical SMILES for phenol;2-phenoxy-1-phenylethanone is O=C(COc1ccccc1)c1ccccc1.Oc1ccccc1.
What is the InChIKey of phenol;2-phenoxy-1-phenylethanone?
The InChIKey is WETSDMJFTRZKLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2.C6H6O/c15-14(12-7-3-1-4-8-12)11-16-13-9-5-2-6-10-13;7-6-4-2-1-3-5-6/h1-10H,11H2;1-5,7H.
What are the key properties of phenol;2-phenoxy-1-phenylethanone?
phenol;2-phenoxy-1-phenylethanone has a molecular weight of 306.36 g/mol, XLogP of 4.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;2-phenoxy-1-phenylethanone is sourced from PubChem (CID 161484281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).