C14H10Cl2O2 — CID 146005989
1-(3,5-dichlorophenyl)-2-phenoxyethanone (PubChem CID 146005989) has the molecular formula C14H10Cl2O2 and a molecular weight of 281.14 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-2-phenoxyethanone.
| Compound Name | 1-(3,5-dichlorophenyl)-2-phenoxyethanone |
|---|---|
| PubChem CID | 146005989 |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2O2/c15-11-6-10(7-12(16)8-11)14(17)9-18-13-4-2-1-3-5-13/h1-8H,9H2 |
| InChIKey | LSXUDKUHUKKVKL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |